MethodMath
Ask
Join
HomeTopicsAskAlerts
Profile

© 2026 MethodMath. Built for mathematical knowledge sharing.

AboutContactGuidelinesPrivacyTermsCookies
Sarah Mitchell
Sarah Mitchell
May 22, 2026

How can I memorize trigonometric identities without rote memorization?

I have a trig final next week and Im drowning in identities.

Theres like 50 of them:

  • Pythagorean identities
  • Angle addition formulas
  • Double angle formulas
  • Half angle formulas
  • Sum-to-product
  • Product-to-sum
  • Power-reducing formulas

I cant memorize all of these! Is there a way to learn them by understanding the connections?

I know that most of them come from:

cos⁡(A+B)=cos⁡Acos⁡B−sin⁡Asin⁡B\cos(A+B) = \cos A \cos B - \sin A \sin Bcos(A+B)=cosAcosB−sinAsinB
sin⁡(A+B)=sin⁡Acos⁡B+cos⁡Asin⁡B\sin(A+B) = \sin A \cos B + \cos A \sin Bsin(A+B)=sinAcosB+cosAsinB

And using A=BA = BA=B gives double angle formulas. Using cos⁡2A+sin⁡2A=1\cos^2 A + \sin^2 A = 1cos2A+sin2A=1 gives the other Pythagorean forms.

But the sum-to-product formulas are still hard. And the half-angle formulas with the ±\pm± signs confuse me.

Also: is it true that Euler formula eiθ=cos⁡θ+isin⁡θe^{i\theta} = \cos\theta + i\sin\thetaeiθ=cosθ+isinθ can generate ALL trig identities automatically? How would that work?

2 answers1.6k views

2 Answers

3
Chen Wei
Chen Wei
May 22, 2026
Accepted
Heres a systematic approach that reduces memorization to just THREE core identities: **Core identities (memorize these):** 1. $\sin^2 \theta + \cos^2 \theta = 1$ 2. $\sin(A+B) = \sin A \cos B + \cos A \sin B$ 3. $\cos(A+B) = \cos A \cos B - \sin A \sin B$ **Everything else comes from these:** **Double angle:** Set $B = A$: $$\sin 2A = 2 \sin A \cos A$$ $$\cos 2A = \cos^2 A - \sin^2 A = 2\cos^2 A - 1 = 1 - 2\sin^2 A$$ **Half angle:** Solve $\cos 2\theta = 1 - 2\sin^2 \theta$ for $\sin\theta$: $$\sin \frac{\theta}{2} = \pm \sqrt{\frac{1 - \cos \theta}{2}}$$ **Using Eulers formula** ($e^{i\theta} = \cos\theta + i\sin\theta$) is the most elegant approach: $$e^{i(A+B)} = e^{iA}e^{iB}$$ $$\cos(A+B) + i\sin(A+B) = (\cos A + i\sin A)(\cos B + i\sin B)$$ Multiply out and equate real/imaginary parts — you get both addition formulas instantly! **For product-to-sum:** Use the addition formulas with $P = (A+B)/2$ and $Q = (A-B)/2$. The $\pm$ signs in half-angle formulas are determined by which quadrant $\theta/2$ lies in. On a unit circle, you can derive this visually.
Still unsure? Join to comment or ask a follow-up.
0
Alex Kim
Alex Kim
May 23, 2026
I would not start with a giant list. Start with a small family tree. The identities I would keep as "parents" are: $$\sin^2 x+\cos^2 x=1$$ and the angle addition formulas: $$\sin(a+b)=\sin a\cos b+\cos a\sin b$$ $$\cos(a+b)=\cos a\cos b-\sin a\sin b.$$ From those, double-angle formulas come from setting $a=b=x$. Power-reducing formulas come from rearranging the double-angle formulas. Many sum-to-product formulas come from adding and subtracting angle formulas. So the study method is: 1. memorize the parent identities, 2. practice deriving the children, 3. keep one page showing the family tree, 4. only memorize the formulas you cannot derive quickly enough for your exam. That feels slower for one day, but much faster after a week because the identities stop looking unrelated.
Login or Register to post your answer

Suggested questions

Why does 0 factorial equal 1 instead of 0? Simple proof

31.4k

Does getting 1 percent better every day really compound to 37 times better?

11.5k

Why is the derivative of x^x not x*x^(x-1)?

11.3k

Does the Banach-Steinhaus theorem hold for non-complete normed spaces?

31.1k

Do I need Calculus 3 before learning Fourier series?

3500